About 3-(butylamino)-2,5-dihydropyrazin-2-ol
3-(butylamino)-2,5-dihydropyrazin-2-ol (PubChem CID 57170433) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(butylamino)-2,5-dihydropyrazin-2-ol.
Molecular Properties
| Compound Name | 3-(butylamino)-2,5-dihydropyrazin-2-ol |
| PubChem CID | 57170433 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(butylamino)-2,5-dihydropyrazin-2-ol |
| SMILES | CCCCNC1=NCC=NC1O |
| InChI | InChI=1S/C8H15N3O/c1-2-3-4-9-7-8(12)11-6-5-10-7/h6,8,12H,2-5H2,1H3,(H,9,10) |
| InChIKey | ZADJAVFLKUNHTK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(butylamino)-2,5-dihydropyrazin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butylamino)-2,5-dihydropyrazin-2-ol?
The IUPAC name of 3-(butylamino)-2,5-dihydropyrazin-2-ol (CID 57170433) is 3-(butylamino)-2,5-dihydropyrazin-2-ol.
What is the SMILES notation for 3-(butylamino)-2,5-dihydropyrazin-2-ol?
The canonical SMILES for 3-(butylamino)-2,5-dihydropyrazin-2-ol is CCCCNC1=NCC=NC1O.
What is the InChIKey of 3-(butylamino)-2,5-dihydropyrazin-2-ol?
The InChIKey is ZADJAVFLKUNHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-2-3-4-9-7-8(12)11-6-5-10-7/h6,8,12H,2-5H2,1H3,(H,9,10).
What are the key properties of 3-(butylamino)-2,5-dihydropyrazin-2-ol?
3-(butylamino)-2,5-dihydropyrazin-2-ol has a molecular weight of 169.23 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butylamino)-2,5-dihydropyrazin-2-ol is sourced from PubChem (CID 57170433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).