C6H10FN — CID 57170630
2-fluoro-3-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 57170630) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is 2-fluoro-3-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-fluoro-3-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 57170630 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 2-fluoro-3-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1C=CCNC1F |
| InChI | InChI=1S/C6H10FN/c1-5-3-2-4-8-6(5)7/h2-3,5-6,8H,4H2,1H3 |
| InChIKey | IYXWAYLOIAXGEO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|