C8H14N2 — CID 57170884
2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yldiazene (PubChem CID 57170884) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yldiazene.
| Compound Name | 2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yldiazene |
|---|---|
| PubChem CID | 57170884 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yldiazene |
| SMILES | [H]/N=N/C12CCCC1CCC2 |
| InChI | InChI=1S/C8H14N2/c9-10-8-5-1-3-7(8)4-2-6-8/h7,9H,1-6H2/b10-9+ |
| InChIKey | GLVWGRMREOVQQG-MDZDMXLPSA-N |
| XLogP | 2.74 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|