About (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate
(3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate (PubChem CID 57171113) has the molecular formula C5H6N2O3S
and a molecular weight of 174.18 g/mol. Its IUPAC name is (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate.
Molecular Properties
| Compound Name | (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate |
| PubChem CID | 57171113 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate |
| SMILES | Cc1nsc(COC(=O)O)n1 |
| InChI | InChI=1S/C5H6N2O3S/c1-3-6-4(11-7-3)2-10-5(8)9/h2H2,1H3,(H,8,9) |
| InChIKey | ACHXXZZJUNHUBR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate?
The IUPAC name of (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate (CID 57171113) is (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate.
What is the SMILES notation for (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate?
The canonical SMILES for (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate is Cc1nsc(COC(=O)O)n1.
What is the InChIKey of (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate?
The InChIKey is ACHXXZZJUNHUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S/c1-3-6-4(11-7-3)2-10-5(8)9/h2H2,1H3,(H,8,9).
What are the key properties of (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate?
(3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate has a molecular weight of 174.18 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2,4-thiadiazol-5-yl)methyl hydrogen carbonate is sourced from PubChem (CID 57171113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).