C22H18N10O — CID 57171367
N-benzyl-9-[6-(furan-2-ylmethylamino)purin-9-yl]purin-6-amine (PubChem CID 57171367) has the molecular formula C22H18N10O and a molecular weight of 438.46 g/mol. Its IUPAC name is N-benzyl-9-[6-(furan-2-ylmethylamino)purin-9-yl]purin-6-amine.
| Compound Name | N-benzyl-9-[6-(furan-2-ylmethylamino)purin-9-yl]purin-6-amine |
|---|---|
| PubChem CID | 57171367 |
| Molecular Formula | C22H18N10O |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-benzyl-9-[6-(furan-2-ylmethylamino)purin-9-yl]purin-6-amine |
| SMILES | c1ccc(CNc2ncnc3c2ncn3-n2cnc3c(NCc4ccco4)ncnc32)cc1 |
| InChI | InChI=1S/C22H18N10O/c1-2-5-15(6-3-1)9-23-19-17-21(27-11-25-19)31(13-29-17)32-14-30-18-20(26-12-28-22(18)32)24-10-16-7-4-8-33-16/h1-8,11-14H,9-10H2,(H,23,25,27)(H,24,26,28) |
| InChIKey | ZTSFWAFHJODPHI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |