C27H43N — CID 57171930
N-(2-cyclohexylethyl)-1-[4-(3,3,5,5-tetramethylcyclohexyl)phenyl]propan-2-imine (PubChem CID 57171930) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-1-[4-(3,3,5,5-tetramethylcyclohexyl)phenyl]propan-2-imine.
| Compound Name | N-(2-cyclohexylethyl)-1-[4-(3,3,5,5-tetramethylcyclohexyl)phenyl]propan-2-imine |
|---|---|
| PubChem CID | 57171930 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | N-(2-cyclohexylethyl)-1-[4-(3,3,5,5-tetramethylcyclohexyl)phenyl]propan-2-imine |
| SMILES | C/C(Cc1ccc(C2CC(C)(C)CC(C)(C)C2)cc1)=N\CCC1CCCCC1 |
| InChI | InChI=1S/C27H43N/c1-21(28-16-15-22-9-7-6-8-10-22)17-23-11-13-24(14-12-23)25-18-26(2,3)20-27(4,5)19-25/h11-14,22,25H,6-10,15-20H2,1-5H3/b28-21+ |
| InChIKey | DXNYDXVWYVHVLP-SGWCAAJKSA-N |
| XLogP | 7.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|