About 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one
3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (PubChem CID 57171943) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| PubChem CID | 57171943 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| SMILES | Cn1cccc1C=C1C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C13H11N3O/c1-16-7-3-4-9(16)8-10-12-11(15-13(10)17)5-2-6-14-12/h2-8H,1H3,(H,15,17) |
| InChIKey | BHRYFKNOPSVNIC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_K(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The IUPAC name of 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (CID 57171943) is 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one.
What is the SMILES notation for 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The canonical SMILES for 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one is Cn1cccc1C=C1C(=O)Nc2cccnc21.
What is the InChIKey of 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
The InChIKey is BHRYFKNOPSVNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-16-7-3-4-9(16)8-10-12-11(15-13(10)17)5-2-6-14-12/h2-8H,1H3,(H,15,17).
What are the key properties of 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one?
3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one has a molecular weight of 225.25 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methylpyrrol-2-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one is sourced from PubChem (CID 57171943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).