C7H7N3S — CID 57172571
3-methyl-2H-pyrido[4,3-e][1,2,4]thiadiazine (PubChem CID 57172571) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 3-methyl-2H-pyrido[4,3-e][1,2,4]thiadiazine.
| Compound Name | 3-methyl-2H-pyrido[4,3-e][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 57172571 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 3-methyl-2H-pyrido[4,3-e][1,2,4]thiadiazine |
| SMILES | CC1=Nc2ccncc2SN1 |
| InChI | InChI=1S/C7H7N3S/c1-5-9-6-2-3-8-4-7(6)11-10-5/h2-4H,1H3,(H,9,10) |
| InChIKey | YPRXLBVEGWROSA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|