C19H22ClNO4S — CID 57172610
diethyl 4-(3-chlorophenyl)-2-methanethioyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 57172610) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is diethyl 4-(3-chlorophenyl)-2-methanethioyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-chlorophenyl)-2-methanethioyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57172610 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | diethyl 4-(3-chlorophenyl)-2-methanethioyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(C=S)C(C(=O)OCC)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-4-24-18(22)15-11(3)21-14(10-26)17(19(23)25-5-2)16(15)12-7-6-8-13(20)9-12/h6-10,14-17H,4-5H2,1-3H3 |
| InChIKey | LLNYYKXLDBRTPY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|