C24H43F3OSi — CID 57172869
[(1R,3aR,4S,7aR)-7a-methyl-1-(7,7,7-trifluoro-6-methylhept-5-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57172869) has the molecular formula C24H43F3OSi and a molecular weight of 432.69 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-7a-methyl-1-(7,7,7-trifluoro-6-methylhept-5-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-7a-methyl-1-(7,7,7-trifluoro-6-methylhept-5-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57172869 |
| Molecular Formula | C24H43F3OSi |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | [(1R,3aR,4S,7aR)-7a-methyl-1-(7,7,7-trifluoro-6-methylhept-5-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(=CCCC(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)C(F)(F)F |
| InChI | InChI=1S/C24H43F3OSi/c1-17(11-9-12-18(2)24(25,26)27)19-14-15-20-21(13-10-16-23(19,20)6)28-29(7,8)22(3,4)5/h12,17,19-21H,9-11,13-16H2,1-8H3/t17?,19-,20+,21+,23-/m1/s1 |
| InChIKey | PRMIZUQBSFFTEM-DBDYQDPBSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|