C22H20ClNO3 — CID 57173008
(4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl) N-benzylcarbamate (PubChem CID 57173008) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl) N-benzylcarbamate.
| Compound Name | (4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl) N-benzylcarbamate |
|---|---|
| PubChem CID | 57173008 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl) N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC(Cc1ccc2ccccc2c1)C(=O)CCl |
| InChI | InChI=1S/C22H20ClNO3/c23-14-20(25)21(27-22(26)24-15-16-6-2-1-3-7-16)13-17-10-11-18-8-4-5-9-19(18)12-17/h1-12,21H,13-15H2,(H,24,26) |
| InChIKey | XWWFOZZLNMLZAR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|