C21H31BrN2O5 — CID 57173020
ethyl (2S)-2-(N-[2-[(2S)-2-amino-3-methylbutanoyl]oxy-2-oxoethyl]-4-bromoanilino)-4-methylpentanoate (PubChem CID 57173020) has the molecular formula C21H31BrN2O5 and a molecular weight of 471.39 g/mol. Its IUPAC name is ethyl (2S)-2-(N-[2-[(2S)-2-amino-3-methylbutanoyl]oxy-2-oxoethyl]-4-bromoanilino)-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-(N-[2-[(2S)-2-amino-3-methylbutanoyl]oxy-2-oxoethyl]-4-bromoanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 57173020 |
| Molecular Formula | C21H31BrN2O5 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | ethyl (2S)-2-(N-[2-[(2S)-2-amino-3-methylbutanoyl]oxy-2-oxoethyl]-4-bromoanilino)-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N(CC(=O)OC(=O)[C@@H](N)C(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H31BrN2O5/c1-6-28-20(26)17(11-13(2)3)24(16-9-7-15(22)8-10-16)12-18(25)29-21(27)19(23)14(4)5/h7-10,13-14,17,19H,6,11-12,23H2,1-5H3/t17-,19-/m0/s1 |
| InChIKey | AGZMVOVCLQIKRS-HKUYNNGSSA-N |
| XLogP | 3.29 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|