C9H18N2O — CID 57173064
1-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine (PubChem CID 57173064) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine |
|---|---|
| PubChem CID | 57173064 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine |
| SMILES | [H]N=C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C9H18N2O/c1-8(2)5-7(10)6-9(3,4)11(8)12/h10,12H,5-6H2,1-4H3 |
| InChIKey | FVRCIBWSPSGKQF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|