C16H15F4N5O — CID 57173760
2-N-[1-(6-methyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 57173760) has the molecular formula C16H15F4N5O and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-N-[1-(6-methyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[1-(6-methyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 57173760 |
| Molecular Formula | C16H15F4N5O |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-N-[1-(6-methyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc2cc(C(C)Nc3nc(N)nc(C(F)(F)C(F)F)n3)oc2c1 |
| InChI | InChI=1S/C16H15F4N5O/c1-7-3-4-9-6-10(26-11(9)5-7)8(2)22-15-24-13(23-14(21)25-15)16(19,20)12(17)18/h3-6,8,12H,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | IXANVLSWRHKDIQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|