methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate

C18H13NO4 — CID 57174062

IUPACmethyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate
SMILESCOC(=O)c1ccccc1C=C1N=C(c2ccccc2)OC1=O
InChIInChI=1S/C18H13NO4/c1-22-17(20)14-10-6-5-9-13(14)11-15-18(21)23-16(19-15)12-7-3-2-4-8-12/h2-11H,1H3
InChIKeyBAVSJELVCICTGP-UHFFFAOYSA-N
MW307.31 g/mol
LogP2.82
Rot. Bonds3

About methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate

methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate (PubChem CID 57174062) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate.

Molecular Properties

Compound Namemethyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate
PubChem CID57174062
Molecular FormulaC18H13NO4
Molecular Weight307.31 g/mol
Exact Mass307.08
IUPAC Namemethyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate
SMILESCOC(=O)c1ccccc1C=C1N=C(c2ccccc2)OC1=O
InChIInChI=1S/C18H13NO4/c1-22-17(20)14-10-6-5-9-13(14)11-15-18(21)23-16(19-15)12-7-3-2-4-8-12/h2-11H,1H3
InChIKeyBAVSJELVCICTGP-UHFFFAOYSA-N
XLogP2.82
TPSA64.96 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.31
LogP ≤ 52.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate?
The IUPAC name of methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate (CID 57174062) is methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate.
What is the SMILES notation for methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate?
The canonical SMILES for methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate is COC(=O)c1ccccc1C=C1N=C(c2ccccc2)OC1=O.
What is the InChIKey of methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate?
The InChIKey is BAVSJELVCICTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO4/c1-22-17(20)14-10-6-5-9-13(14)11-15-18(21)23-16(19-15)12-7-3-2-4-8-12/h2-11H,1H3.
What are the key properties of methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate?
methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate has a molecular weight of 307.31 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]benzoate is sourced from PubChem (CID 57174062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).