About methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate
methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate (PubChem CID 57174193) has the molecular formula C23H35NO5Si
and a molecular weight of 433.62 g/mol. Its IUPAC name is methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate.
Molecular Properties
| Compound Name | methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate |
| PubChem CID | 57174193 |
| Molecular Formula | C23H35NO5Si |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate |
| SMILES | COC(=O)CCC(=O)N1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H35NO5Si/c1-15(2)30(16(3)4,17(5)6)29-22-21(18-11-9-8-10-12-18)24(23(22)27)19(25)13-14-20(26)28-7/h8-12,15-17,21-22H,13-14H2,1-7H3/t21-,22+/m0/s1 |
| InChIKey | WTCAYTYVXUBVNV-FCHUYYIVSA-N |
| XLogP | 4.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate?
The IUPAC name of methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate (CID 57174193) is methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate.
What is the SMILES notation for methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate?
The canonical SMILES for methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate is COC(=O)CCC(=O)N1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1c1ccccc1.
What is the InChIKey of methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate?
The InChIKey is WTCAYTYVXUBVNV-FCHUYYIVSA-N. The full InChI is InChI=1S/C23H35NO5Si/c1-15(2)30(16(3)4,17(5)6)29-22-21(18-11-9-8-10-12-18)24(23(22)27)19(25)13-14-20(26)28-7/h8-12,15-17,21-22H,13-14H2,1-7H3/t21-,22+/m0/s1.
What are the key properties of methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate?
methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate has a molecular weight of 433.62 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-4-[(3R,4S)-2-oxo-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-1-yl]butanoate is sourced from PubChem (CID 57174193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).