C20H23N3O2 — CID 57174885
1-[1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethyl]-3-methylurea (PubChem CID 57174885) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethyl]-3-methylurea.
| Compound Name | 1-[1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethyl]-3-methylurea |
|---|---|
| PubChem CID | 57174885 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethyl]-3-methylurea |
| SMILES | CNC(=O)NC(Cc1ccccc1)C1C=C(Cc2ccccc2)NO1 |
| InChI | InChI=1S/C20H23N3O2/c1-21-20(24)22-18(13-16-10-6-3-7-11-16)19-14-17(23-25-19)12-15-8-4-2-5-9-15/h2-11,14,18-19,23H,12-13H2,1H3,(H2,21,22,24) |
| InChIKey | XKPDGYQUCVPXTB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |