About 2-(sulfinatoamino)hexane
2-(sulfinatoamino)hexane (PubChem CID 57174932) has the molecular formula C6H14NO2S-
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-(sulfinatoamino)hexane.
Molecular Properties
| Compound Name | 2-(sulfinatoamino)hexane |
| PubChem CID | 57174932 |
| Molecular Formula | C6H14NO2S- |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-(sulfinatoamino)hexane |
| SMILES | CCCCC(C)NS(=O)[O-] |
| InChI | InChI=1S/C6H15NO2S/c1-3-4-5-6(2)7-10(8)9/h6-7H,3-5H2,1-2H3,(H,8,9)/p-1 |
| InChIKey | WCRXGRUXBQHKDF-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(sulfinatoamino)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(sulfinatoamino)hexane?
The IUPAC name of 2-(sulfinatoamino)hexane (CID 57174932) is 2-(sulfinatoamino)hexane.
What is the SMILES notation for 2-(sulfinatoamino)hexane?
The canonical SMILES for 2-(sulfinatoamino)hexane is CCCCC(C)NS(=O)[O-].
What is the InChIKey of 2-(sulfinatoamino)hexane?
The InChIKey is WCRXGRUXBQHKDF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO2S/c1-3-4-5-6(2)7-10(8)9/h6-7H,3-5H2,1-2H3,(H,8,9)/p-1.
What are the key properties of 2-(sulfinatoamino)hexane?
2-(sulfinatoamino)hexane has a molecular weight of 164.25 g/mol, XLogP of 0.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfinatoamino)hexane is sourced from PubChem (CID 57174932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).