About 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea
1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea (PubChem CID 57175145) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea |
| PubChem CID | 57175145 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea |
| SMILES | CC(C1C=C(c2ccc3ccccc3c2)NO1)N(O)C(N)=O |
| InChI | InChI=1S/C16H17N3O3/c1-10(19(21)16(17)20)15-9-14(18-22-15)13-7-6-11-4-2-3-5-12(11)8-13/h2-10,15,18,21H,1H3,(H2,17,20) |
| InChIKey | RPRUSPKXWBLDGY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea?
The IUPAC name of 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea (CID 57175145) is 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea.
What is the SMILES notation for 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea?
The canonical SMILES for 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea is CC(C1C=C(c2ccc3ccccc3c2)NO1)N(O)C(N)=O.
What is the InChIKey of 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea?
The InChIKey is RPRUSPKXWBLDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-10(19(21)16(17)20)15-9-14(18-22-15)13-7-6-11-4-2-3-5-12(11)8-13/h2-10,15,18,21H,1H3,(H2,17,20).
What are the key properties of 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea?
1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea has a molecular weight of 299.33 g/mol, XLogP of 2.24, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1-[1-(3-naphthalen-2-yl-2,5-dihydro-1,2-oxazol-5-yl)ethyl]urea is sourced from PubChem (CID 57175145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).