C26H43NO5S — CID 57175365
1,3,7,15-tetrahydroxy-4,4,8,12,16-pentamethyl-7-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one (PubChem CID 57175365) has the molecular formula C26H43NO5S and a molecular weight of 481.70 g/mol. Its IUPAC name is 1,3,7,15-tetrahydroxy-4,4,8,12,16-pentamethyl-7-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one.
| Compound Name | 1,3,7,15-tetrahydroxy-4,4,8,12,16-pentamethyl-7-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 57175365 |
| Molecular Formula | C26H43NO5S |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 1,3,7,15-tetrahydroxy-4,4,8,12,16-pentamethyl-7-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one |
| SMILES | C=C(C)C(O)CC=C(C)CCCC(C)C(O)(CC(=O)C(C)(C)C(O)CCO)c1csc(C)n1 |
| InChI | InChI=1S/C26H43NO5S/c1-17(2)21(29)12-11-18(3)9-8-10-19(4)26(32,22-16-33-20(5)27-22)15-24(31)25(6,7)23(30)13-14-28/h11,16,19,21,23,28-30,32H,1,8-10,12-15H2,2-7H3 |
| InChIKey | AQLPBWCMVYNFQW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|