C26H30O3S — CID 57175453
ethyl 4-[2-(7-ethylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]benzoate (PubChem CID 57175453) has the molecular formula C26H30O3S and a molecular weight of 422.59 g/mol. Its IUPAC name is ethyl 4-[2-(7-ethylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(7-ethylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 57175453 |
| Molecular Formula | C26H30O3S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | ethyl 4-[2-(7-ethylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2cc3c(cc2SCC)OC(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C26H30O3S/c1-7-28-24(27)19-12-9-18(10-13-19)11-14-20-15-21-22(16-23(20)30-8-2)29-26(5,6)17-25(21,3)4/h9-10,12-13,15-16H,7-8,17H2,1-6H3 |
| InChIKey | JGCYJLGJZHDTQC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|