About 2-(1,3-dioxolan-2-yl)pyrazine
2-(1,3-dioxolan-2-yl)pyrazine (PubChem CID 57176001) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)pyrazine |
| PubChem CID | 57176001 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)pyrazine |
| SMILES | c1cnc(C2OCCO2)cn1 |
| InChI | InChI=1S/C7H8N2O2/c1-2-9-6(5-8-1)7-10-3-4-11-7/h1-2,5,7H,3-4H2 |
| InChIKey | JJKMQRMTPZWLCZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxolan-2-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)pyrazine?
The IUPAC name of 2-(1,3-dioxolan-2-yl)pyrazine (CID 57176001) is 2-(1,3-dioxolan-2-yl)pyrazine.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)pyrazine?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)pyrazine is c1cnc(C2OCCO2)cn1.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)pyrazine?
The InChIKey is JJKMQRMTPZWLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-2-9-6(5-8-1)7-10-3-4-11-7/h1-2,5,7H,3-4H2.
What are the key properties of 2-(1,3-dioxolan-2-yl)pyrazine?
2-(1,3-dioxolan-2-yl)pyrazine has a molecular weight of 152.15 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)pyrazine is sourced from PubChem (CID 57176001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).