C21H42N2O2 — CID 57176008
1-methoxy-4-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 57176008) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-methoxy-4-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-methoxy-4-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 57176008 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | 1-methoxy-4-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CON1C(C)(C)CC(CC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C21H42N2O2/c1-18(2)12-16(13-19(3,4)22(18)24-9)11-17-14-20(5,6)23(25-10)21(7,8)15-17/h16-17H,11-15H2,1-10H3 |
| InChIKey | RUFFTXXOMNKJFW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |