C11H16O3 — CID 57176176
1-ethenoxy-4-methylideneoctane-3,6-dione (PubChem CID 57176176) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-ethenoxy-4-methylideneoctane-3,6-dione.
| Compound Name | 1-ethenoxy-4-methylideneoctane-3,6-dione |
|---|---|
| PubChem CID | 57176176 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-ethenoxy-4-methylideneoctane-3,6-dione |
| SMILES | C=COCCC(=O)C(=C)CC(=O)CC |
| InChI | InChI=1S/C11H16O3/c1-4-10(12)8-9(3)11(13)6-7-14-5-2/h5H,2-4,6-8H2,1H3 |
| InChIKey | OHNCZTSAZFKHOL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|