C12H18N4OS — CID 57176280
N-cyclopentyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide (PubChem CID 57176280) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is N-cyclopentyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide.
| Compound Name | N-cyclopentyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 57176280 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-cyclopentyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
| SMILES | O=C(N1CCc2nc[nH]c2C1)N(S)C1CCCC1 |
| InChI | InChI=1S/C12H18N4OS/c17-12(16(18)9-3-1-2-4-9)15-6-5-10-11(7-15)14-8-13-10/h8-9,18H,1-7H2,(H,13,14) |
| InChIKey | SECJLCLSKKYFII-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|