About 3,3-dimethoxyoxolane
3,3-dimethoxyoxolane (PubChem CID 57176327) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3,3-dimethoxyoxolane.
Molecular Properties
| Compound Name | 3,3-dimethoxyoxolane |
| PubChem CID | 57176327 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3,3-dimethoxyoxolane |
| SMILES | COC1(OC)CCOC1 |
| InChI | InChI=1S/C6H12O3/c1-7-6(8-2)3-4-9-5-6/h3-5H2,1-2H3 |
| InChIKey | DOLJOERLFKHNEY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethoxyoxolane?
The IUPAC name of 3,3-dimethoxyoxolane (CID 57176327) is 3,3-dimethoxyoxolane.
What is the SMILES notation for 3,3-dimethoxyoxolane?
The canonical SMILES for 3,3-dimethoxyoxolane is COC1(OC)CCOC1.
What is the InChIKey of 3,3-dimethoxyoxolane?
The InChIKey is DOLJOERLFKHNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-7-6(8-2)3-4-9-5-6/h3-5H2,1-2H3.
What are the key properties of 3,3-dimethoxyoxolane?
3,3-dimethoxyoxolane has a molecular weight of 132.16 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethoxyoxolane is sourced from PubChem (CID 57176327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).