C19H16N4O5 — CID 57176393
N,8-dimethyl-5-(4-nitrophenyl)-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide (PubChem CID 57176393) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is N,8-dimethyl-5-(4-nitrophenyl)-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide.
| Compound Name | N,8-dimethyl-5-(4-nitrophenyl)-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide |
|---|---|
| PubChem CID | 57176393 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N,8-dimethyl-5-(4-nitrophenyl)-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)c2cc3c(cc2C=C1C)OCO3 |
| InChI | InChI=1S/C19H16N4O5/c1-11-7-13-8-16-17(28-10-27-16)9-15(13)18(21-22(11)19(24)20-2)12-3-5-14(6-4-12)23(25)26/h3-9H,10H2,1-2H3,(H,20,24) |
| InChIKey | PHFLHBDLLSVKKN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|