About (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate
(7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate (PubChem CID 57177041) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate.
Molecular Properties
| Compound Name | (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate |
| PubChem CID | 57177041 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1ncn2c1COc1cc(N)ccc1-2 |
| InChI | InChI=1S/C13H13N3O4/c1-2-18-13(17)20-12-10-6-19-11-5-8(14)3-4-9(11)16(10)7-15-12/h3-5,7H,2,6,14H2,1H3 |
| InChIKey | LCPHGEGTHMSHJW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate?
The IUPAC name of (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate (CID 57177041) is (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate.
What is the SMILES notation for (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate?
The canonical SMILES for (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate is CCOC(=O)Oc1ncn2c1COc1cc(N)ccc1-2.
What is the InChIKey of (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate?
The InChIKey is LCPHGEGTHMSHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4/c1-2-18-13(17)20-12-10-6-19-11-5-8(14)3-4-9(11)16(10)7-15-12/h3-5,7H,2,6,14H2,1H3.
What are the key properties of (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate?
(7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate has a molecular weight of 275.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl) ethyl carbonate is sourced from PubChem (CID 57177041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).