C18H23Cl2N3O3 — CID 57177117
(1S,2R,3S,5S)-3-[5,6-dichloro-2-(cyclopentylamino)benzimidazol-1-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 57177117) has the molecular formula C18H23Cl2N3O3 and a molecular weight of 400.31 g/mol. Its IUPAC name is (1S,2R,3S,5S)-3-[5,6-dichloro-2-(cyclopentylamino)benzimidazol-1-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5S)-3-[5,6-dichloro-2-(cyclopentylamino)benzimidazol-1-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 57177117 |
| Molecular Formula | C18H23Cl2N3O3 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (1S,2R,3S,5S)-3-[5,6-dichloro-2-(cyclopentylamino)benzimidazol-1-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | OC[C@@H]1C[C@H](n2c(NC3CCCC3)nc3cc(Cl)c(Cl)cc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23Cl2N3O3/c19-11-6-13-14(7-12(11)20)23(15-5-9(8-24)16(25)17(15)26)18(22-13)21-10-3-1-2-4-10/h6-7,9-10,15-17,24-26H,1-5,8H2,(H,21,22)/t9-,15-,16-,17+/m0/s1 |
| InChIKey | ODUVHBZLVYFODX-VHYHWGNDSA-N |
| XLogP | 2.97 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |