About [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate
[3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate (PubChem CID 57177118) has the molecular formula C20H28O6
and a molecular weight of 364.44 g/mol. Its IUPAC name is [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate.
Molecular Properties
| Compound Name | [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate |
| PubChem CID | 57177118 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate |
| SMILES | CCC=C(CCC)C(=O)OCCC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H28O6/c1-6-8-14(9-7-2)20(22)26-11-10-16(21)15-12-17(23-3)19(25-5)18(13-15)24-4/h8,12-13H,6-7,9-11H2,1-5H3 |
| InChIKey | FQDRFKBGJPEOAU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate?
The IUPAC name of [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate (CID 57177118) is [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate.
What is the SMILES notation for [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate?
The canonical SMILES for [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate is CCC=C(CCC)C(=O)OCCC(=O)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate?
The InChIKey is FQDRFKBGJPEOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O6/c1-6-8-14(9-7-2)20(22)26-11-10-16(21)15-12-17(23-3)19(25-5)18(13-15)24-4/h8,12-13H,6-7,9-11H2,1-5H3.
What are the key properties of [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate?
[3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate has a molecular weight of 364.44 g/mol, XLogP of 3.96, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-3-(3,4,5-trimethoxyphenyl)propyl] 2-propylpent-2-enoate is sourced from PubChem (CID 57177118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).