C13H24O7 — CID 57177516
1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-pentoxyoxan-3-yl]ethanone (PubChem CID 57177516) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-pentoxyoxan-3-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-pentoxyoxan-3-yl]ethanone |
|---|---|
| PubChem CID | 57177516 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-pentoxyoxan-3-yl]ethanone |
| SMILES | CCCCCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C13H24O7/c1-3-4-5-6-19-12-13(18,8(2)15)11(17)10(16)9(7-14)20-12/h9-12,14,16-18H,3-7H2,1-2H3/t9-,10+,11+,12+,13-/m1/s1 |
| InChIKey | AFBLXOIAAFSQJR-QNWJLWSRSA-N |
| XLogP | -1.05 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|