About 4,8a-dihydro-1H-carbazole
4,8a-dihydro-1H-carbazole (PubChem CID 57177752) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4,8a-dihydro-1H-carbazole.
Molecular Properties
| Compound Name | 4,8a-dihydro-1H-carbazole |
| PubChem CID | 57177752 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4,8a-dihydro-1H-carbazole |
| SMILES | C1=CC2=C3CC=CCC3=NC2C=C1 |
| InChI | InChI=1S/C12H11N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-5,7,11H,6,8H2 |
| InChIKey | IAFRNUZWVLAVLC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,8a-dihydro-1H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8a-dihydro-1H-carbazole?
The IUPAC name of 4,8a-dihydro-1H-carbazole (CID 57177752) is 4,8a-dihydro-1H-carbazole.
What is the SMILES notation for 4,8a-dihydro-1H-carbazole?
The canonical SMILES for 4,8a-dihydro-1H-carbazole is C1=CC2=C3CC=CCC3=NC2C=C1.
What is the InChIKey of 4,8a-dihydro-1H-carbazole?
The InChIKey is IAFRNUZWVLAVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-5,7,11H,6,8H2.
What are the key properties of 4,8a-dihydro-1H-carbazole?
4,8a-dihydro-1H-carbazole has a molecular weight of 169.23 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8a-dihydro-1H-carbazole is sourced from PubChem (CID 57177752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).