C23H23ClN4O3 — CID 57177930
6-[8-chloro-1-(hydroxymethyl)-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexanoic acid (PubChem CID 57177930) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 6-[8-chloro-1-(hydroxymethyl)-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexanoic acid.
| Compound Name | 6-[8-chloro-1-(hydroxymethyl)-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 57177930 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 6-[8-chloro-1-(hydroxymethyl)-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCC1N=C(c2ccccc2)c2cc(Cl)ccc2-n2c(CO)nnc21 |
| InChI | InChI=1S/C23H23ClN4O3/c24-16-11-12-19-17(13-16)22(15-7-3-1-4-8-15)25-18(9-5-2-6-10-21(30)31)23-27-26-20(14-29)28(19)23/h1,3-4,7-8,11-13,18,29H,2,5-6,9-10,14H2,(H,30,31) |
| InChIKey | CUEUTGABHHKEMX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|