C21H27FO5 — CID 57178167
2-[2-[(3aR,4R,5R,6aS)-4-[3-(4-fluorophenyl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 57178167) has the molecular formula C21H27FO5 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[2-[(3aR,4R,5R,6aS)-4-[3-(4-fluorophenyl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aR,4R,5R,6aS)-4-[3-(4-fluorophenyl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 57178167 |
| Molecular Formula | C21H27FO5 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[2-[(3aR,4R,5R,6aS)-4-[3-(4-fluorophenyl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC1C[C@H]2C[C@@H](O)[C@H](C=CC(O)c3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C21H27FO5/c22-16-3-1-14(2-4-16)19(23)6-5-17-18-10-13(7-8-27-12-21(25)26)9-15(18)11-20(17)24/h1-6,13,15,17-20,23-24H,7-12H2,(H,25,26)/t13?,15-,17+,18+,19?,20+/m0/s1 |
| InChIKey | AUHBUVAQBFDWED-OKGVGOLBSA-N |
| XLogP | 2.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|