About 4-amino-2-oxobutanal
4-amino-2-oxobutanal (PubChem CID 57178288) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is 4-amino-2-oxobutanal.
Molecular Properties
| Compound Name | 4-amino-2-oxobutanal |
| PubChem CID | 57178288 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | 4-amino-2-oxobutanal |
| SMILES | NCCC(=O)C=O |
| InChI | InChI=1S/C4H7NO2/c5-2-1-4(7)3-6/h3H,1-2,5H2 |
| InChIKey | VTNMMWLMUSUBMO-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-oxobutanal?
The IUPAC name of 4-amino-2-oxobutanal (CID 57178288) is 4-amino-2-oxobutanal.
What is the SMILES notation for 4-amino-2-oxobutanal?
The canonical SMILES for 4-amino-2-oxobutanal is NCCC(=O)C=O.
What is the InChIKey of 4-amino-2-oxobutanal?
The InChIKey is VTNMMWLMUSUBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c5-2-1-4(7)3-6/h3H,1-2,5H2.
What are the key properties of 4-amino-2-oxobutanal?
4-amino-2-oxobutanal has a molecular weight of 101.10 g/mol, XLogP of -0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-oxobutanal is sourced from PubChem (CID 57178288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).