C24H30ClN7O3S — CID 57178457
1-[[2-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylpyrrol-2-yl]methyl]-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide (PubChem CID 57178457) has the molecular formula C24H30ClN7O3S and a molecular weight of 532.07 g/mol. Its IUPAC name is 1-[[2-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylpyrrol-2-yl]methyl]-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-[[2-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylpyrrol-2-yl]methyl]-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 57178457 |
| Molecular Formula | C24H30ClN7O3S |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 1-[[2-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylpyrrol-2-yl]methyl]-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide |
| SMILES | CNCCNC(=O)C1(CC2(S(=O)(=O)c3ccc4c(Cl)cnc(N=C(N)N)c4c3)C=CC=N2)CCCC1 |
| InChI | InChI=1S/C24H30ClN7O3S/c1-28-11-12-29-21(33)23(7-2-3-8-23)15-24(9-4-10-31-24)36(34,35)16-5-6-17-18(13-16)20(32-22(26)27)30-14-19(17)25/h4-6,9-10,13-14,28H,2-3,7-8,11-12,15H2,1H3,(H,29,33)(H4,26,27,30,32) |
| InChIKey | IJFFCZVAVJJPNX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 164.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|