C12H9F3O4S — CID 57178711
S-(7-methoxy-4-oxo-2,3-dihydrochromen-3-yl) 2,2,2-trifluoroethanethioate (PubChem CID 57178711) has the molecular formula C12H9F3O4S and a molecular weight of 306.26 g/mol. Its IUPAC name is S-(7-methoxy-4-oxo-2,3-dihydrochromen-3-yl) 2,2,2-trifluoroethanethioate.
| Compound Name | S-(7-methoxy-4-oxo-2,3-dihydrochromen-3-yl) 2,2,2-trifluoroethanethioate |
|---|---|
| PubChem CID | 57178711 |
| Molecular Formula | C12H9F3O4S |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | S-(7-methoxy-4-oxo-2,3-dihydrochromen-3-yl) 2,2,2-trifluoroethanethioate |
| SMILES | COc1ccc2c(c1)OCC(SC(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C12H9F3O4S/c1-18-6-2-3-7-8(4-6)19-5-9(10(7)16)20-11(17)12(13,14)15/h2-4,9H,5H2,1H3 |
| InChIKey | CLTLCVZEYJUIAZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|