About cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone
cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone (PubChem CID 57178800) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone |
| PubChem CID | 57178800 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone |
| SMILES | CC(C1=NC(C)(C)CO1)c1ccc(C(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-13(18-20-19(2,3)12-22-18)14-8-10-16(11-9-14)17(21)15-6-4-5-7-15/h8-11,13,15H,4-7,12H2,1-3H3 |
| InChIKey | JUEKBTWXIJZUIG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone?
The IUPAC name of cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone (CID 57178800) is cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone.
What is the SMILES notation for cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone?
The canonical SMILES for cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone is CC(C1=NC(C)(C)CO1)c1ccc(C(=O)C2CCCC2)cc1.
What is the InChIKey of cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone?
The InChIKey is JUEKBTWXIJZUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2/c1-13(18-20-19(2,3)12-22-18)14-8-10-16(11-9-14)17(21)15-6-4-5-7-15/h8-11,13,15H,4-7,12H2,1-3H3.
What are the key properties of cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone?
cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone has a molecular weight of 299.41 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[4-[1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]phenyl]methanone is sourced from PubChem (CID 57178800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).