C22H30N2O — CID 57179015
N-[3-(diethylamino)propyl]-2,2-diphenylpropanamide (PubChem CID 57179015) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2,2-diphenylpropanamide.
| Compound Name | N-[3-(diethylamino)propyl]-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 57179015 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2,2-diphenylpropanamide |
| SMILES | CCN(CC)CCCNC(=O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-4-24(5-2)18-12-17-23-21(25)22(3,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16H,4-5,12,17-18H2,1-3H3,(H,23,25) |
| InChIKey | BULTUZVJVVBDGB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|