C19H17BrN2 — CID 57179239
19-bromo-8-azatetracyclo[13.5.0.01,6.09,14]icosa-3,5,8,10,12,14,19-heptaen-17-imine (PubChem CID 57179239) has the molecular formula C19H17BrN2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 19-bromo-8-azatetracyclo[13.5.0.01,6.09,14]icosa-3,5,8,10,12,14,19-heptaen-17-imine.
| Compound Name | 19-bromo-8-azatetracyclo[13.5.0.01,6.09,14]icosa-3,5,8,10,12,14,19-heptaen-17-imine |
|---|---|
| PubChem CID | 57179239 |
| Molecular Formula | C19H17BrN2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 19-bromo-8-azatetracyclo[13.5.0.01,6.09,14]icosa-3,5,8,10,12,14,19-heptaen-17-imine |
| SMILES | [H]/N=C1\CC(Br)=CC23CC=CC=C2CN=c2ccccc2=C3C1 |
| InChI | InChI=1S/C19H17BrN2/c20-14-9-15(21)10-17-16-6-1-2-7-18(16)22-12-13-5-3-4-8-19(13,17)11-14/h1-7,11,21H,8-10,12H2/b21-15+ |
| InChIKey | OYTHJLLUZMHFHD-RCCKNPSSSA-N |
| XLogP | 3.44 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|