About 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione
1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione (PubChem CID 57179242) has the molecular formula C8H5N3O4
and a molecular weight of 207.15 g/mol. Its IUPAC name is 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione |
| PubChem CID | 57179242 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H5N3O4/c12-5-1-2-6(13)10(5)9-11-7(14)3-4-8(11)15/h1-4,9H |
| InChIKey | FIWXLGIQSDJUTQ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione?
The IUPAC name of 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione (CID 57179242) is 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione.
What is the SMILES notation for 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione?
The canonical SMILES for 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione is O=C1C=CC(=O)N1NN1C(=O)C=CC1=O.
What is the InChIKey of 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione?
The InChIKey is FIWXLGIQSDJUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O4/c12-5-1-2-6(13)10(5)9-11-7(14)3-4-8(11)15/h1-4,9H.
What are the key properties of 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione?
1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione has a molecular weight of 207.15 g/mol, XLogP of -1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dioxopyrrol-1-yl)amino]pyrrole-2,5-dione is sourced from PubChem (CID 57179242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).