About ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate
ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate (PubChem CID 57179577) has the molecular formula C17H19Cl2NO3
and a molecular weight of 356.25 g/mol. Its IUPAC name is ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate.
Molecular Properties
| Compound Name | ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate |
| PubChem CID | 57179577 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate |
| SMILES | CCOC(=O)C(Cl)CC(c1ccc(Cl)cc1)C(C)c1ncco1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-3-22-17(21)15(19)10-14(11(2)16-20-8-9-23-16)12-4-6-13(18)7-5-12/h4-9,11,14-15H,3,10H2,1-2H3 |
| InChIKey | RVDUIBZQTJGADE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate?
The IUPAC name of ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate (CID 57179577) is ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate.
What is the SMILES notation for ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate?
The canonical SMILES for ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate is CCOC(=O)C(Cl)CC(c1ccc(Cl)cc1)C(C)c1ncco1.
What is the InChIKey of ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate?
The InChIKey is RVDUIBZQTJGADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2NO3/c1-3-22-17(21)15(19)10-14(11(2)16-20-8-9-23-16)12-4-6-13(18)7-5-12/h4-9,11,14-15H,3,10H2,1-2H3.
What are the key properties of ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate?
ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate has a molecular weight of 356.25 g/mol, XLogP of 4.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chloro-4-(4-chlorophenyl)-5-(1,3-oxazol-2-yl)hexanoate is sourced from PubChem (CID 57179577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).