C8H15N5S — CID 57179626
[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]methanethiol (PubChem CID 57179626) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]methanethiol.
| Compound Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]methanethiol |
|---|---|
| PubChem CID | 57179626 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]methanethiol |
| SMILES | CCNc1nc(CS)nc(NCC)n1 |
| InChI | InChI=1S/C8H15N5S/c1-3-9-7-11-6(5-14)12-8(13-7)10-4-2/h14H,3-5H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | CRGABBAWEFBERO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|