C28H42O9S — CID 57179663
2-sulfo-2,3-bis[2-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl]butanedioic acid (PubChem CID 57179663) has the molecular formula C28H42O9S and a molecular weight of 554.70 g/mol. Its IUPAC name is 2-sulfo-2,3-bis[2-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl]butanedioic acid.
| Compound Name | 2-sulfo-2,3-bis[2-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 57179663 |
| Molecular Formula | C28H42O9S |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-sulfo-2,3-bis[2-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl]butanedioic acid |
| SMILES | O=C(O)C(CCOC1CC2CC1C1CCCC21)C(CCOC1CC2CC1C1CCCC21)(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C28H42O9S/c29-26(30)23(7-9-36-24-13-15-11-21(24)19-5-1-3-17(15)19)28(27(31)32,38(33,34)35)8-10-37-25-14-16-12-22(25)20-6-2-4-18(16)20/h15-25H,1-14H2,(H,29,30)(H,31,32)(H,33,34,35) |
| InChIKey | NBNXZOSNDWJWLF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|