C15H24F6N2 — CID 57179760
[4-(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]hydrazine (PubChem CID 57179760) has the molecular formula C15H24F6N2 and a molecular weight of 346.36 g/mol. Its IUPAC name is [4-(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]hydrazine.
| Compound Name | [4-(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]hydrazine |
|---|---|
| PubChem CID | 57179760 |
| Molecular Formula | C15H24F6N2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [4-(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]hydrazine |
| SMILES | NNC1CCC(C(C2CCCCC2)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F6N2/c16-14(17,18)13(15(19,20)21,10-4-2-1-3-5-10)11-6-8-12(23-22)9-7-11/h10-12,23H,1-9,22H2 |
| InChIKey | XXFVGRCBJQMOKB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|