About (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal
(2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal (PubChem CID 57179786) has the molecular formula C14H27NO4S
and a molecular weight of 305.44 g/mol. Its IUPAC name is (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal.
Molecular Properties
| Compound Name | (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal |
| PubChem CID | 57179786 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal |
| SMILES | CC(C)S(O)(O)[C@@H](C=O)C(=O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H27NO4S/c1-10(2)20(18,19)13(9-16)14(17)12(15)8-11-6-4-3-5-7-11/h9-13,18-19H,3-8,15H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | PVJAAVFNAYBLPD-STQMWFEESA-N |
| XLogP | 2.58 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal?
The IUPAC name of (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal (CID 57179786) is (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal.
What is the SMILES notation for (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal?
The canonical SMILES for (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal is CC(C)S(O)(O)[C@@H](C=O)C(=O)[C@@H](N)CC1CCCCC1.
What is the InChIKey of (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal?
The InChIKey is PVJAAVFNAYBLPD-STQMWFEESA-N. The full InChI is InChI=1S/C14H27NO4S/c1-10(2)20(18,19)13(9-16)14(17)12(15)8-11-6-4-3-5-7-11/h9-13,18-19H,3-8,15H2,1-2H3/t12-,13-/m0/s1.
What are the key properties of (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal?
(2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal has a molecular weight of 305.44 g/mol, XLogP of 2.58, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-amino-5-cyclohexyl-2-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-3-oxopentanal is sourced from PubChem (CID 57179786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).