C12H15NO — CID 57180230
1-(3-amino-2,3-dihydro-1H-inden-4-yl)propan-1-one (PubChem CID 57180230) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(3-amino-2,3-dihydro-1H-inden-4-yl)propan-1-one.
| Compound Name | 1-(3-amino-2,3-dihydro-1H-inden-4-yl)propan-1-one |
|---|---|
| PubChem CID | 57180230 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(3-amino-2,3-dihydro-1H-inden-4-yl)propan-1-one |
| SMILES | CCC(=O)c1cccc2c1C(N)CC2 |
| InChI | InChI=1S/C12H15NO/c1-2-11(14)9-5-3-4-8-6-7-10(13)12(8)9/h3-5,10H,2,6-7,13H2,1H3 |
| InChIKey | UASAOEHGFJVGFU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |