About (2,4-dioxopentylideneamino) phenylmethanesulfonate
(2,4-dioxopentylideneamino) phenylmethanesulfonate (PubChem CID 57180294) has the molecular formula C12H13NO5S
and a molecular weight of 283.31 g/mol. Its IUPAC name is (2,4-dioxopentylideneamino) phenylmethanesulfonate.
Molecular Properties
| Compound Name | (2,4-dioxopentylideneamino) phenylmethanesulfonate |
| PubChem CID | 57180294 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2,4-dioxopentylideneamino) phenylmethanesulfonate |
| SMILES | CC(=O)CC(=O)C=NOS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H13NO5S/c1-10(14)7-12(15)8-13-18-19(16,17)9-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3 |
| InChIKey | LOBOBZYEBNSKTE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dioxopentylideneamino) phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxopentylideneamino) phenylmethanesulfonate?
The IUPAC name of (2,4-dioxopentylideneamino) phenylmethanesulfonate (CID 57180294) is (2,4-dioxopentylideneamino) phenylmethanesulfonate.
What is the SMILES notation for (2,4-dioxopentylideneamino) phenylmethanesulfonate?
The canonical SMILES for (2,4-dioxopentylideneamino) phenylmethanesulfonate is CC(=O)CC(=O)C=NOS(=O)(=O)Cc1ccccc1.
What is the InChIKey of (2,4-dioxopentylideneamino) phenylmethanesulfonate?
The InChIKey is LOBOBZYEBNSKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5S/c1-10(14)7-12(15)8-13-18-19(16,17)9-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3.
What are the key properties of (2,4-dioxopentylideneamino) phenylmethanesulfonate?
(2,4-dioxopentylideneamino) phenylmethanesulfonate has a molecular weight of 283.31 g/mol, XLogP of 1.07, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxopentylideneamino) phenylmethanesulfonate is sourced from PubChem (CID 57180294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).