C12H12O12 — CID 57180365
2-[1-(1,2-dicarboxy-2-hydroxyethoxy)-1-oxobuta-2,3-dien-2-yl]-2-hydroxybutanedioic acid (PubChem CID 57180365) has the molecular formula C12H12O12 and a molecular weight of 348.22 g/mol. Its IUPAC name is 2-[1-(1,2-dicarboxy-2-hydroxyethoxy)-1-oxobuta-2,3-dien-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[1-(1,2-dicarboxy-2-hydroxyethoxy)-1-oxobuta-2,3-dien-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 57180365 |
| Molecular Formula | C12H12O12 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[1-(1,2-dicarboxy-2-hydroxyethoxy)-1-oxobuta-2,3-dien-2-yl]-2-hydroxybutanedioic acid |
| SMILES | C=C=C(C(=O)OC(C(=O)O)C(O)C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H12O12/c1-2-4(12(23,11(21)22)3-5(13)14)10(20)24-7(9(18)19)6(15)8(16)17/h6-7,15,23H,1,3H2,(H,13,14)(H,16,17)(H,18,19)(H,21,22) |
| InChIKey | BVAKYLUJMYQMGY-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 215.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|