C13H12N2 — CID 57181186
5,10-diazatricyclo[9.4.0.01,6]pentadeca-2,4,6,9,11,13-hexaene (PubChem CID 57181186) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 5,10-diazatricyclo[9.4.0.01,6]pentadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 5,10-diazatricyclo[9.4.0.01,6]pentadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 57181186 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5,10-diazatricyclo[9.4.0.01,6]pentadeca-2,4,6,9,11,13-hexaene |
| SMILES | C1=CCC23C=CC=NC2=CCC=NC3=C1 |
| InChI | InChI=1S/C13H12N2/c1-2-7-13-8-4-10-15-12(13)6-3-9-14-11(13)5-1/h1-2,4-6,8-10H,3,7H2 |
| InChIKey | KEPZOOBFUCQPPN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |